C23H29FN2O3S — CID 28541243
(2S)-N-cyclooctyl-2-[(4-fluorophenyl)sulfonylamino]-3-phenylpropanamide (PubChem CID 28541243) has the molecular formula C23H29FN2O3S and a molecular weight of 432.56 g/mol. Its IUPAC name is (2S)-N-cyclooctyl-2-[(4-fluorophenyl)sulfonylamino]-3-phenylpropanamide.
| Compound Name | (2S)-N-cyclooctyl-2-[(4-fluorophenyl)sulfonylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 28541243 |
| Molecular Formula | C23H29FN2O3S |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | (2S)-N-cyclooctyl-2-[(4-fluorophenyl)sulfonylamino]-3-phenylpropanamide |
| SMILES | O=C(NC1CCCCCCC1)[C@H](Cc1ccccc1)NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H29FN2O3S/c24-19-13-15-21(16-14-19)30(28,29)26-22(17-18-9-5-4-6-10-18)23(27)25-20-11-7-2-1-3-8-12-20/h4-6,9-10,13-16,20,22,26H,1-3,7-8,11-12,17H2,(H,25,27)/t22-/m0/s1 |
| InChIKey | WHXQBEBAILITOX-QFIPXVFZSA-N |
| XLogP | 3.94 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |