C24H31ClN2O4S — CID 43891057
2-[(3-chloro-4-ethoxyphenyl)sulfonylamino]-N-cycloheptyl-3-phenylpropanamide (PubChem CID 43891057) has the molecular formula C24H31ClN2O4S and a molecular weight of 479.04 g/mol. Its IUPAC name is 2-[(3-chloro-4-ethoxyphenyl)sulfonylamino]-N-cycloheptyl-3-phenylpropanamide.
| Compound Name | 2-[(3-chloro-4-ethoxyphenyl)sulfonylamino]-N-cycloheptyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 43891057 |
| Molecular Formula | C24H31ClN2O4S |
| Molecular Weight | 479.04 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | 2-[(3-chloro-4-ethoxyphenyl)sulfonylamino]-N-cycloheptyl-3-phenylpropanamide |
| SMILES | CCOc1ccc(S(=O)(=O)NC(Cc2ccccc2)C(=O)NC2CCCCCC2)cc1Cl |
| InChI | InChI=1S/C24H31ClN2O4S/c1-2-31-23-15-14-20(17-21(23)25)32(29,30)27-22(16-18-10-6-5-7-11-18)24(28)26-19-12-8-3-4-9-13-19/h5-7,10-11,14-15,17,19,22,27H,2-4,8-9,12-13,16H2,1H3,(H,26,28) |
| InChIKey | VXXRQJZIJTYOJK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.04 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |