C22H29ClN2O4S — CID 30166400
(2R)-2-[(3-chloro-4-ethoxyphenyl)sulfonylamino]-N-(3-methylbutyl)-3-phenylpropanamide (PubChem CID 30166400) has the molecular formula C22H29ClN2O4S and a molecular weight of 453.00 g/mol. Its IUPAC name is (2R)-2-[(3-chloro-4-ethoxyphenyl)sulfonylamino]-N-(3-methylbutyl)-3-phenylpropanamide.
| Compound Name | (2R)-2-[(3-chloro-4-ethoxyphenyl)sulfonylamino]-N-(3-methylbutyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 30166400 |
| Molecular Formula | C22H29ClN2O4S |
| Molecular Weight | 453.00 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | (2R)-2-[(3-chloro-4-ethoxyphenyl)sulfonylamino]-N-(3-methylbutyl)-3-phenylpropanamide |
| SMILES | CCOc1ccc(S(=O)(=O)N[C@H](Cc2ccccc2)C(=O)NCCC(C)C)cc1Cl |
| InChI | InChI=1S/C22H29ClN2O4S/c1-4-29-21-11-10-18(15-19(21)23)30(27,28)25-20(14-17-8-6-5-7-9-17)22(26)24-13-12-16(2)3/h5-11,15-16,20,25H,4,12-14H2,1-3H3,(H,24,26)/t20-/m1/s1 |
| InChIKey | AAEKKLGTWGPPRX-HXUWFJFHSA-N |
| XLogP | 3.79 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.00 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |