C25H33ClN2O4S — CID 30166427
(2S)-2-[(3-chloro-4-ethoxyphenyl)sulfonylamino]-N-cyclooctyl-3-phenylpropanamide (PubChem CID 30166427) has the molecular formula C25H33ClN2O4S and a molecular weight of 493.07 g/mol. Its IUPAC name is (2S)-2-[(3-chloro-4-ethoxyphenyl)sulfonylamino]-N-cyclooctyl-3-phenylpropanamide.
| Compound Name | (2S)-2-[(3-chloro-4-ethoxyphenyl)sulfonylamino]-N-cyclooctyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 30166427 |
| Molecular Formula | C25H33ClN2O4S |
| Molecular Weight | 493.07 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | (2S)-2-[(3-chloro-4-ethoxyphenyl)sulfonylamino]-N-cyclooctyl-3-phenylpropanamide |
| SMILES | CCOc1ccc(S(=O)(=O)N[C@@H](Cc2ccccc2)C(=O)NC2CCCCCCC2)cc1Cl |
| InChI | InChI=1S/C25H33ClN2O4S/c1-2-32-24-16-15-21(18-22(24)26)33(30,31)28-23(17-19-11-7-6-8-12-19)25(29)27-20-13-9-4-3-5-10-14-20/h6-8,11-12,15-16,18,20,23,28H,2-5,9-10,13-14,17H2,1H3,(H,27,29)/t23-/m0/s1 |
| InChIKey | YUMYVESFMYWOMN-QHCPKHFHSA-N |
| XLogP | 4.86 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.07 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |