C30H29ClN2O4S — CID 94863263
(2R)-N-benzhydryl-2-[(3-chloro-4-ethoxyphenyl)sulfonylamino]-3-phenylpropanamide (PubChem CID 94863263) has the molecular formula C30H29ClN2O4S and a molecular weight of 549.09 g/mol. Its IUPAC name is (2R)-N-benzhydryl-2-[(3-chloro-4-ethoxyphenyl)sulfonylamino]-3-phenylpropanamide.
| Compound Name | (2R)-N-benzhydryl-2-[(3-chloro-4-ethoxyphenyl)sulfonylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 94863263 |
| Molecular Formula | C30H29ClN2O4S |
| Molecular Weight | 549.09 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | (2R)-N-benzhydryl-2-[(3-chloro-4-ethoxyphenyl)sulfonylamino]-3-phenylpropanamide |
| SMILES | CCOc1ccc(S(=O)(=O)N[C@H](Cc2ccccc2)C(=O)NC(c2ccccc2)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C30H29ClN2O4S/c1-2-37-28-19-18-25(21-26(28)31)38(35,36)33-27(20-22-12-6-3-7-13-22)30(34)32-29(23-14-8-4-9-15-23)24-16-10-5-11-17-24/h3-19,21,27,29,33H,2,20H2,1H3,(H,32,34)/t27-/m1/s1 |
| InChIKey | XPKJYIUMPVZFDZ-HHHXNRCGSA-N |
| XLogP | 5.53 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.09 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |