C31H32N2O4S — CID 43890919
N-benzhydryl-2-[(4-ethoxy-3-methylphenyl)sulfonylamino]-3-phenylpropanamide (PubChem CID 43890919) has the molecular formula C31H32N2O4S and a molecular weight of 528.67 g/mol. Its IUPAC name is N-benzhydryl-2-[(4-ethoxy-3-methylphenyl)sulfonylamino]-3-phenylpropanamide.
| Compound Name | N-benzhydryl-2-[(4-ethoxy-3-methylphenyl)sulfonylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 43890919 |
| Molecular Formula | C31H32N2O4S |
| Molecular Weight | 528.67 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | N-benzhydryl-2-[(4-ethoxy-3-methylphenyl)sulfonylamino]-3-phenylpropanamide |
| SMILES | CCOc1ccc(S(=O)(=O)NC(Cc2ccccc2)C(=O)NC(c2ccccc2)c2ccccc2)cc1C |
| InChI | InChI=1S/C31H32N2O4S/c1-3-37-29-20-19-27(21-23(29)2)38(35,36)33-28(22-24-13-7-4-8-14-24)31(34)32-30(25-15-9-5-10-16-25)26-17-11-6-12-18-26/h4-21,28,30,33H,3,22H2,1-2H3,(H,32,34) |
| InChIKey | DRLGXPSJIVQYHO-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.67 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |