C19H21IN2O4S — CID 1303995
2-[N-(benzenesulfonyl)-4-iodoanilino]-N-[[(2R)-oxolan-2-yl]methyl]acetamide (PubChem CID 1303995) has the molecular formula C19H21IN2O4S and a molecular weight of 500.36 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-iodoanilino]-N-[[(2R)-oxolan-2-yl]methyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-iodoanilino]-N-[[(2R)-oxolan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 1303995 |
| Molecular Formula | C19H21IN2O4S |
| Molecular Weight | 500.36 g/mol |
| Exact Mass | 500.03 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-iodoanilino]-N-[[(2R)-oxolan-2-yl]methyl]acetamide |
| SMILES | O=C(CN(c1ccc(I)cc1)S(=O)(=O)c1ccccc1)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C19H21IN2O4S/c20-15-8-10-16(11-9-15)22(27(24,25)18-6-2-1-3-7-18)14-19(23)21-13-17-5-4-12-26-17/h1-3,6-11,17H,4-5,12-14H2,(H,21,23)/t17-/m1/s1 |
| InChIKey | PFYFERFANBZHTO-QGZVFWFLSA-N |
| XLogP | 2.78 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|