C19H20Cl2N2O4S — CID 1138641
2-[N-(benzenesulfonyl)-3,5-dichloroanilino]-N-[[(2S)-oxolan-2-yl]methyl]acetamide (PubChem CID 1138641) has the molecular formula C19H20Cl2N2O4S and a molecular weight of 443.35 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3,5-dichloroanilino]-N-[[(2S)-oxolan-2-yl]methyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3,5-dichloroanilino]-N-[[(2S)-oxolan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 1138641 |
| Molecular Formula | C19H20Cl2N2O4S |
| Molecular Weight | 443.35 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3,5-dichloroanilino]-N-[[(2S)-oxolan-2-yl]methyl]acetamide |
| SMILES | O=C(CN(c1cc(Cl)cc(Cl)c1)S(=O)(=O)c1ccccc1)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C19H20Cl2N2O4S/c20-14-9-15(21)11-16(10-14)23(28(25,26)18-6-2-1-3-7-18)13-19(24)22-12-17-5-4-8-27-17/h1-3,6-7,9-11,17H,4-5,8,12-13H2,(H,22,24)/t17-/m0/s1 |
| InChIKey | BVXSYTLHHJEBIC-KRWDZBQOSA-N |
| XLogP | 3.48 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |