C16H19N3O6S2 — CID 10364401
[4-[(2S)-2-(benzenesulfonamido)-3-(methylamino)-3-oxopropyl]phenyl]sulfamic acid (PubChem CID 10364401) has the molecular formula C16H19N3O6S2 and a molecular weight of 413.48 g/mol. Its IUPAC name is [4-[(2S)-2-(benzenesulfonamido)-3-(methylamino)-3-oxopropyl]phenyl]sulfamic acid.
| Compound Name | [4-[(2S)-2-(benzenesulfonamido)-3-(methylamino)-3-oxopropyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 10364401 |
| Molecular Formula | C16H19N3O6S2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | [4-[(2S)-2-(benzenesulfonamido)-3-(methylamino)-3-oxopropyl]phenyl]sulfamic acid |
| SMILES | CNC(=O)[C@H](Cc1ccc(NS(=O)(=O)O)cc1)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H19N3O6S2/c1-17-16(20)15(19-26(21,22)14-5-3-2-4-6-14)11-12-7-9-13(10-8-12)18-27(23,24)25/h2-10,15,18-19H,11H2,1H3,(H,17,20)(H,23,24,25)/t15-/m0/s1 |
| InChIKey | UUAZZXHDJNVXHF-HNNXBMFYSA-N |
| XLogP | 0.54 |
| TPSA | 141.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|