C19H23N3O5S — CID 10024248
[4-[(2R)-3-(methylamino)-3-oxo-2-(3-phenylpropanoylamino)propyl]phenyl]sulfamic acid (PubChem CID 10024248) has the molecular formula C19H23N3O5S and a molecular weight of 405.48 g/mol. Its IUPAC name is [4-[(2R)-3-(methylamino)-3-oxo-2-(3-phenylpropanoylamino)propyl]phenyl]sulfamic acid.
| Compound Name | [4-[(2R)-3-(methylamino)-3-oxo-2-(3-phenylpropanoylamino)propyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 10024248 |
| Molecular Formula | C19H23N3O5S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | [4-[(2R)-3-(methylamino)-3-oxo-2-(3-phenylpropanoylamino)propyl]phenyl]sulfamic acid |
| SMILES | CNC(=O)[C@@H](Cc1ccc(NS(=O)(=O)O)cc1)NC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C19H23N3O5S/c1-20-19(24)17(21-18(23)12-9-14-5-3-2-4-6-14)13-15-7-10-16(11-8-15)22-28(25,26)27/h2-8,10-11,17,22H,9,12-13H2,1H3,(H,20,24)(H,21,23)(H,25,26,27)/t17-/m1/s1 |
| InChIKey | MKNKAZCKQOVQAC-QGZVFWFLSA-N |
| XLogP | 1.31 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|