C16H19N3O3S — CID 132520532
(2S)-2-amino-N'-(4-methylphenyl)sulfonyl-3-phenylpropanehydrazide (PubChem CID 132520532) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is (2S)-2-amino-N'-(4-methylphenyl)sulfonyl-3-phenylpropanehydrazide.
| Compound Name | (2S)-2-amino-N'-(4-methylphenyl)sulfonyl-3-phenylpropanehydrazide |
|---|---|
| PubChem CID | 132520532 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | (2S)-2-amino-N'-(4-methylphenyl)sulfonyl-3-phenylpropanehydrazide |
| SMILES | Cc1ccc(S(=O)(=O)NNC(=O)[C@@H](N)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C16H19N3O3S/c1-12-7-9-14(10-8-12)23(21,22)19-18-16(20)15(17)11-13-5-3-2-4-6-13/h2-10,15,19H,11,17H2,1H3,(H,18,20)/t15-/m0/s1 |
| InChIKey | ZWSCETSGUBZWAB-HNNXBMFYSA-N |
| XLogP | 0.87 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|