C18H22N4O4S — CID 131888129
N-[2-[2-[(2R)-2-amino-3-phenylpropanoyl]hydrazinyl]-2-oxoethyl]-4-methylbenzenesulfonamide (PubChem CID 131888129) has the molecular formula C18H22N4O4S and a molecular weight of 390.47 g/mol. Its IUPAC name is N-[2-[2-[(2R)-2-amino-3-phenylpropanoyl]hydrazinyl]-2-oxoethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-[2-[(2R)-2-amino-3-phenylpropanoyl]hydrazinyl]-2-oxoethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 131888129 |
| Molecular Formula | C18H22N4O4S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | N-[2-[2-[(2R)-2-amino-3-phenylpropanoyl]hydrazinyl]-2-oxoethyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC(=O)NNC(=O)[C@H](N)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C18H22N4O4S/c1-13-7-9-15(10-8-13)27(25,26)20-12-17(23)21-22-18(24)16(19)11-14-5-3-2-4-6-14/h2-10,16,20H,11-12,19H2,1H3,(H,21,23)(H,22,24)/t16-/m1/s1 |
| InChIKey | ZIBRFHARYMSJKJ-MRXNPFEDSA-N |
| XLogP | -0.01 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|