C27H31N3O5S — CID 18425188
N-[4-[[1-(hydroxyamino)-1-oxo-3-phenylpropan-2-yl]sulfamoyl]phenyl]-4-pentylbenzamide (PubChem CID 18425188) has the molecular formula C27H31N3O5S and a molecular weight of 509.63 g/mol. Its IUPAC name is N-[4-[[1-(hydroxyamino)-1-oxo-3-phenylpropan-2-yl]sulfamoyl]phenyl]-4-pentylbenzamide.
| Compound Name | N-[4-[[1-(hydroxyamino)-1-oxo-3-phenylpropan-2-yl]sulfamoyl]phenyl]-4-pentylbenzamide |
|---|---|
| PubChem CID | 18425188 |
| Molecular Formula | C27H31N3O5S |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | N-[4-[[1-(hydroxyamino)-1-oxo-3-phenylpropan-2-yl]sulfamoyl]phenyl]-4-pentylbenzamide |
| SMILES | CCCCCc1ccc(C(=O)Nc2ccc(S(=O)(=O)NC(Cc3ccccc3)C(=O)NO)cc2)cc1 |
| InChI | InChI=1S/C27H31N3O5S/c1-2-3-5-8-20-11-13-22(14-12-20)26(31)28-23-15-17-24(18-16-23)36(34,35)30-25(27(32)29-33)19-21-9-6-4-7-10-21/h4,6-7,9-18,25,30,33H,2-3,5,8,19H2,1H3,(H,28,31)(H,29,32) |
| InChIKey | SAXMLXSVTLWZLO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|