C23H21NO3S — CID 134879610
N-[(1S)-1,4-diphenylbut-3-ynyl]-4-methoxybenzenesulfonamide (PubChem CID 134879610) has the molecular formula C23H21NO3S and a molecular weight of 391.49 g/mol. Its IUPAC name is N-[(1S)-1,4-diphenylbut-3-ynyl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[(1S)-1,4-diphenylbut-3-ynyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 134879610 |
| Molecular Formula | C23H21NO3S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | N-[(1S)-1,4-diphenylbut-3-ynyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N[C@@H](CC#Cc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H21NO3S/c1-27-21-15-17-22(18-16-21)28(25,26)24-23(20-12-6-3-7-13-20)14-8-11-19-9-4-2-5-10-19/h2-7,9-10,12-13,15-18,23-24H,14H2,1H3/t23-/m0/s1 |
| InChIKey | KIMZLZXUUQNPPK-QHCPKHFHSA-N |
| XLogP | 4.16 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|