C22H19NO3S — CID 102410740
N-[(1S)-1,3-diphenylprop-2-ynyl]-4-methoxybenzenesulfonamide (PubChem CID 102410740) has the molecular formula C22H19NO3S and a molecular weight of 377.47 g/mol. Its IUPAC name is N-[(1S)-1,3-diphenylprop-2-ynyl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[(1S)-1,3-diphenylprop-2-ynyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 102410740 |
| Molecular Formula | C22H19NO3S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | N-[(1S)-1,3-diphenylprop-2-ynyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N[C@H](C#Cc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H19NO3S/c1-26-20-13-15-21(16-14-20)27(24,25)23-22(19-10-6-3-7-11-19)17-12-18-8-4-2-5-9-18/h2-11,13-16,22-23H,1H3/t22-/m1/s1 |
| InChIKey | GHJDHDFWKFMAKN-JOCHJYFZSA-N |
| XLogP | 3.77 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|