C31H27NO6S — CID 10840201
(2R,3R)-2-[[4-(4-methoxyphenyl)phenyl]sulfonylamino]-5-phenyl-3-phenylmethoxypent-4-ynoic acid (PubChem CID 10840201) has the molecular formula C31H27NO6S and a molecular weight of 541.63 g/mol. Its IUPAC name is (2R,3R)-2-[[4-(4-methoxyphenyl)phenyl]sulfonylamino]-5-phenyl-3-phenylmethoxypent-4-ynoic acid.
| Compound Name | (2R,3R)-2-[[4-(4-methoxyphenyl)phenyl]sulfonylamino]-5-phenyl-3-phenylmethoxypent-4-ynoic acid |
|---|---|
| PubChem CID | 10840201 |
| Molecular Formula | C31H27NO6S |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | (2R,3R)-2-[[4-(4-methoxyphenyl)phenyl]sulfonylamino]-5-phenyl-3-phenylmethoxypent-4-ynoic acid |
| SMILES | COc1ccc(-c2ccc(S(=O)(=O)N[C@@H](C(=O)O)[C@@H](C#Cc3ccccc3)OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C31H27NO6S/c1-37-27-17-13-25(14-18-27)26-15-19-28(20-16-26)39(35,36)32-30(31(33)34)29(21-12-23-8-4-2-5-9-23)38-22-24-10-6-3-7-11-24/h2-11,13-20,29-30,32H,22H2,1H3,(H,33,34)/t29-,30-/m1/s1 |
| InChIKey | TYFXGYABSVUPRB-LOYHVIPDSA-N |
| XLogP | 4.73 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|