C25H23NO6S — CID 21252976
[[4-(4-methoxyphenyl)phenyl]sulfonylamino]methyl 5-phenylpent-4-yneperoxoate (PubChem CID 21252976) has the molecular formula C25H23NO6S and a molecular weight of 465.53 g/mol. Its IUPAC name is [[4-(4-methoxyphenyl)phenyl]sulfonylamino]methyl 5-phenylpent-4-yneperoxoate.
| Compound Name | [[4-(4-methoxyphenyl)phenyl]sulfonylamino]methyl 5-phenylpent-4-yneperoxoate |
|---|---|
| PubChem CID | 21252976 |
| Molecular Formula | C25H23NO6S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | [[4-(4-methoxyphenyl)phenyl]sulfonylamino]methyl 5-phenylpent-4-yneperoxoate |
| SMILES | COc1ccc(-c2ccc(S(=O)(=O)NCOOC(=O)CCC#Cc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C25H23NO6S/c1-30-23-15-11-21(12-16-23)22-13-17-24(18-14-22)33(28,29)26-19-31-32-25(27)10-6-5-9-20-7-3-2-4-8-20/h2-4,7-8,11-18,26H,6,10,19H2,1H3 |
| InChIKey | ZKXJHKGORXXBKK-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|