C18H19NO3S — CID 90553137
4-ethyl-N-[3-(4-methoxyphenyl)prop-2-ynyl]benzenesulfonamide (PubChem CID 90553137) has the molecular formula C18H19NO3S and a molecular weight of 329.42 g/mol. Its IUPAC name is 4-ethyl-N-[3-(4-methoxyphenyl)prop-2-ynyl]benzenesulfonamide.
| Compound Name | 4-ethyl-N-[3-(4-methoxyphenyl)prop-2-ynyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90553137 |
| Molecular Formula | C18H19NO3S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 4-ethyl-N-[3-(4-methoxyphenyl)prop-2-ynyl]benzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NCC#Cc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C18H19NO3S/c1-3-15-8-12-18(13-9-15)23(20,21)19-14-4-5-16-6-10-17(22-2)11-7-16/h6-13,19H,3,14H2,1-2H3 |
| InChIKey | BLMQXOJEUUMACW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|