C21H18O — CID 54570199
1-ethyl-4-[6-(4-methoxyphenyl)hex-3-en-1,5-diynyl]benzene (PubChem CID 54570199) has the molecular formula C21H18O and a molecular weight of 286.37 g/mol. Its IUPAC name is 1-ethyl-4-[6-(4-methoxyphenyl)hex-3-en-1,5-diynyl]benzene.
| Compound Name | 1-ethyl-4-[6-(4-methoxyphenyl)hex-3-en-1,5-diynyl]benzene |
|---|---|
| PubChem CID | 54570199 |
| Molecular Formula | C21H18O |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 1-ethyl-4-[6-(4-methoxyphenyl)hex-3-en-1,5-diynyl]benzene |
| SMILES | CCc1ccc(C#CC=CC#Cc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C21H18O/c1-3-18-10-12-19(13-11-18)8-6-4-5-7-9-20-14-16-21(22-2)17-15-20/h4-5,10-17H,3H2,1-2H3 |
| InChIKey | ZWRYVAIAIUUSEG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|