C21H19NO5S — CID 10524866
methyl 2-[[4-[2-(4-methoxyphenyl)ethynyl]phenyl]sulfonylamino]pent-4-ynoate (PubChem CID 10524866) has the molecular formula C21H19NO5S and a molecular weight of 397.45 g/mol. Its IUPAC name is methyl 2-[[4-[2-(4-methoxyphenyl)ethynyl]phenyl]sulfonylamino]pent-4-ynoate.
| Compound Name | methyl 2-[[4-[2-(4-methoxyphenyl)ethynyl]phenyl]sulfonylamino]pent-4-ynoate |
|---|---|
| PubChem CID | 10524866 |
| Molecular Formula | C21H19NO5S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | methyl 2-[[4-[2-(4-methoxyphenyl)ethynyl]phenyl]sulfonylamino]pent-4-ynoate |
| SMILES | C#CCC(NS(=O)(=O)c1ccc(C#Cc2ccc(OC)cc2)cc1)C(=O)OC |
| InChI | InChI=1S/C21H19NO5S/c1-4-5-20(21(23)27-3)22-28(24,25)19-14-10-17(11-15-19)7-6-16-8-12-18(26-2)13-9-16/h1,8-15,20,22H,5H2,2-3H3 |
| InChIKey | WPTKKOOWCCSFFE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|