C16H22N2O6S — CID 86604866
(2R)-N-(2,2-dimethoxyethyl)-2-[(4-methoxyphenyl)sulfonylamino]pent-4-ynamide (PubChem CID 86604866) has the molecular formula C16H22N2O6S and a molecular weight of 370.43 g/mol. Its IUPAC name is (2R)-N-(2,2-dimethoxyethyl)-2-[(4-methoxyphenyl)sulfonylamino]pent-4-ynamide.
| Compound Name | (2R)-N-(2,2-dimethoxyethyl)-2-[(4-methoxyphenyl)sulfonylamino]pent-4-ynamide |
|---|---|
| PubChem CID | 86604866 |
| Molecular Formula | C16H22N2O6S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | (2R)-N-(2,2-dimethoxyethyl)-2-[(4-methoxyphenyl)sulfonylamino]pent-4-ynamide |
| SMILES | C#CC[C@@H](NS(=O)(=O)c1ccc(OC)cc1)C(=O)NCC(OC)OC |
| InChI | InChI=1S/C16H22N2O6S/c1-5-6-14(16(19)17-11-15(23-3)24-4)18-25(20,21)13-9-7-12(22-2)8-10-13/h1,7-10,14-15,18H,6,11H2,2-4H3,(H,17,19)/t14-/m1/s1 |
| InChIKey | WZSWDRSVTQEKSM-CQSZACIVSA-N |
| XLogP | 0.10 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|