About 4-(2,4-dioxo-1H-pyrimidin-3-yl)-2-[hydroxy-(4-methoxyphenyl)sulfonylamino]butanamide
4-(2,4-dioxo-1H-pyrimidin-3-yl)-2-[hydroxy-(4-methoxyphenyl)sulfonylamino]butanamide (PubChem CID 90849821) has the molecular formula C15H18N4O7S
and a molecular weight of 398.40 g/mol. Its IUPAC name is 4-(2,4-dioxo-1H-pyrimidin-3-yl)-2-[hydroxy-(4-methoxyphenyl)sulfonylamino]butanamide.
Molecular Properties
| Compound Name | 4-(2,4-dioxo-1H-pyrimidin-3-yl)-2-[hydroxy-(4-methoxyphenyl)sulfonylamino]butanamide |
| PubChem CID | 90849821 |
| Molecular Formula | C15H18N4O7S |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 4-(2,4-dioxo-1H-pyrimidin-3-yl)-2-[hydroxy-(4-methoxyphenyl)sulfonylamino]butanamide |
| SMILES | COc1ccc(S(=O)(=O)N(O)C(CCn2c(=O)cc[nH]c2=O)C(N)=O)cc1 |
| InChI | InChI=1S/C15H18N4O7S/c1-26-10-2-4-11(5-3-10)27(24,25)19(23)12(14(16)21)7-9-18-13(20)6-8-17-15(18)22/h2-6,8,12,23H,7,9H2,1H3,(H2,16,21)(H,17,22) |
| InChIKey | HSDQUNGLOBQOMO-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 164.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,4-dioxo-1H-pyrimidin-3-yl)-2-[hydroxy-(4-methoxyphenyl)sulfonylamino]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-dioxo-1H-pyrimidin-3-yl)-2-[hydroxy-(4-methoxyphenyl)sulfonylamino]butanamide?
The IUPAC name of 4-(2,4-dioxo-1H-pyrimidin-3-yl)-2-[hydroxy-(4-methoxyphenyl)sulfonylamino]butanamide (CID 90849821) is 4-(2,4-dioxo-1H-pyrimidin-3-yl)-2-[hydroxy-(4-methoxyphenyl)sulfonylamino]butanamide.
What is the SMILES notation for 4-(2,4-dioxo-1H-pyrimidin-3-yl)-2-[hydroxy-(4-methoxyphenyl)sulfonylamino]butanamide?
The canonical SMILES for 4-(2,4-dioxo-1H-pyrimidin-3-yl)-2-[hydroxy-(4-methoxyphenyl)sulfonylamino]butanamide is COc1ccc(S(=O)(=O)N(O)C(CCn2c(=O)cc[nH]c2=O)C(N)=O)cc1.
What is the InChIKey of 4-(2,4-dioxo-1H-pyrimidin-3-yl)-2-[hydroxy-(4-methoxyphenyl)sulfonylamino]butanamide?
The InChIKey is HSDQUNGLOBQOMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N4O7S/c1-26-10-2-4-11(5-3-10)27(24,25)19(23)12(14(16)21)7-9-18-13(20)6-8-17-15(18)22/h2-6,8,12,23H,7,9H2,1H3,(H2,16,21)(H,17,22).
What are the key properties of 4-(2,4-dioxo-1H-pyrimidin-3-yl)-2-[hydroxy-(4-methoxyphenyl)sulfonylamino]butanamide?
4-(2,4-dioxo-1H-pyrimidin-3-yl)-2-[hydroxy-(4-methoxyphenyl)sulfonylamino]butanamide has a molecular weight of 398.40 g/mol, XLogP of -1.13, 8 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dioxo-1H-pyrimidin-3-yl)-2-[hydroxy-(4-methoxyphenyl)sulfonylamino]butanamide is sourced from PubChem (CID 90849821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).