C20H20N2O7S — CID 56948937
4-(1,3-dioxoisoindol-2-yl)-2-(4-methoxy-N-methylsulfonylanilino)butanoic acid (PubChem CID 56948937) has the molecular formula C20H20N2O7S and a molecular weight of 432.45 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-2-(4-methoxy-N-methylsulfonylanilino)butanoic acid.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-2-(4-methoxy-N-methylsulfonylanilino)butanoic acid |
|---|---|
| PubChem CID | 56948937 |
| Molecular Formula | C20H20N2O7S |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-2-(4-methoxy-N-methylsulfonylanilino)butanoic acid |
| SMILES | COc1ccc(N(C(CCN2C(=O)c3ccccc3C2=O)C(=O)O)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H20N2O7S/c1-29-14-9-7-13(8-10-14)22(30(2,27)28)17(20(25)26)11-12-21-18(23)15-5-3-4-6-16(15)19(21)24/h3-10,17H,11-12H2,1-2H3,(H,25,26) |
| InChIKey | RQVXPUYLDCUCOP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|