C17H20N2O6 — CID 175528679
6-(1,3-dioxoisoindol-2-yl)-2-[methoxycarbonyl(methyl)amino]hexanoic acid (PubChem CID 175528679) has the molecular formula C17H20N2O6 and a molecular weight of 348.36 g/mol. Its IUPAC name is 6-(1,3-dioxoisoindol-2-yl)-2-[methoxycarbonyl(methyl)amino]hexanoic acid.
| Compound Name | 6-(1,3-dioxoisoindol-2-yl)-2-[methoxycarbonyl(methyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 175528679 |
| Molecular Formula | C17H20N2O6 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 6-(1,3-dioxoisoindol-2-yl)-2-[methoxycarbonyl(methyl)amino]hexanoic acid |
| SMILES | COC(=O)N(C)C(CCCCN1C(=O)c2ccccc2C1=O)C(=O)O |
| InChI | InChI=1S/C17H20N2O6/c1-18(17(24)25-2)13(16(22)23)9-5-6-10-19-14(20)11-7-3-4-8-12(11)15(19)21/h3-4,7-8,13H,5-6,9-10H2,1-2H3,(H,22,23) |
| InChIKey | LZYPFUURDLBKAK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|