C16H18N2O5 — CID 138972413
methyl N-[5-(1,3-dioxoisoindol-2-yl)-1-oxopentan-2-yl]-N-methylcarbamate (PubChem CID 138972413) has the molecular formula C16H18N2O5 and a molecular weight of 318.33 g/mol. Its IUPAC name is methyl N-[5-(1,3-dioxoisoindol-2-yl)-1-oxopentan-2-yl]-N-methylcarbamate.
| Compound Name | methyl N-[5-(1,3-dioxoisoindol-2-yl)-1-oxopentan-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 138972413 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | methyl N-[5-(1,3-dioxoisoindol-2-yl)-1-oxopentan-2-yl]-N-methylcarbamate |
| SMILES | COC(=O)N(C)C(C=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H18N2O5/c1-17(16(22)23-2)11(10-19)6-5-9-18-14(20)12-7-3-4-8-13(12)15(18)21/h3-4,7-8,10-11H,5-6,9H2,1-2H3 |
| InChIKey | RZNXEQRKGOYTFT-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|