C24H28N2O4 — CID 3891356
N-tert-butyl-4-(1,3-dioxoisoindol-2-yl)-N-[(4-methoxyphenyl)methyl]butanamide (PubChem CID 3891356) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is N-tert-butyl-4-(1,3-dioxoisoindol-2-yl)-N-[(4-methoxyphenyl)methyl]butanamide.
| Compound Name | N-tert-butyl-4-(1,3-dioxoisoindol-2-yl)-N-[(4-methoxyphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 3891356 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | N-tert-butyl-4-(1,3-dioxoisoindol-2-yl)-N-[(4-methoxyphenyl)methyl]butanamide |
| SMILES | COc1ccc(CN(C(=O)CCCN2C(=O)c3ccccc3C2=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H28N2O4/c1-24(2,3)26(16-17-11-13-18(30-4)14-12-17)21(27)10-7-15-25-22(28)19-8-5-6-9-20(19)23(25)29/h5-6,8-9,11-14H,7,10,15-16H2,1-4H3 |
| InChIKey | GDNWQEMEWHNSLU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|