C25H22N2O4 — CID 55385096
N-benzyl-3-(1,3-dioxoisoindol-2-yl)-N-(4-methoxyphenyl)propanamide (PubChem CID 55385096) has the molecular formula C25H22N2O4 and a molecular weight of 414.46 g/mol. Its IUPAC name is N-benzyl-3-(1,3-dioxoisoindol-2-yl)-N-(4-methoxyphenyl)propanamide.
| Compound Name | N-benzyl-3-(1,3-dioxoisoindol-2-yl)-N-(4-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 55385096 |
| Molecular Formula | C25H22N2O4 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | N-benzyl-3-(1,3-dioxoisoindol-2-yl)-N-(4-methoxyphenyl)propanamide |
| SMILES | COc1ccc(N(Cc2ccccc2)C(=O)CCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C25H22N2O4/c1-31-20-13-11-19(12-14-20)27(17-18-7-3-2-4-8-18)23(28)15-16-26-24(29)21-9-5-6-10-22(21)25(26)30/h2-14H,15-17H2,1H3 |
| InChIKey | HPWKGYJUVPRTII-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|