C23H21F3N2O3 — CID 46588656
N-cyclopropyl-4-(1,3-dioxoisoindol-2-yl)-N-[[4-(trifluoromethyl)phenyl]methyl]butanamide (PubChem CID 46588656) has the molecular formula C23H21F3N2O3 and a molecular weight of 430.43 g/mol. Its IUPAC name is N-cyclopropyl-4-(1,3-dioxoisoindol-2-yl)-N-[[4-(trifluoromethyl)phenyl]methyl]butanamide.
| Compound Name | N-cyclopropyl-4-(1,3-dioxoisoindol-2-yl)-N-[[4-(trifluoromethyl)phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 46588656 |
| Molecular Formula | C23H21F3N2O3 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | N-cyclopropyl-4-(1,3-dioxoisoindol-2-yl)-N-[[4-(trifluoromethyl)phenyl]methyl]butanamide |
| SMILES | O=C1c2ccccc2C(=O)N1CCCC(=O)N(Cc1ccc(C(F)(F)F)cc1)C1CC1 |
| InChI | InChI=1S/C23H21F3N2O3/c24-23(25,26)16-9-7-15(8-10-16)14-28(17-11-12-17)20(29)6-3-13-27-21(30)18-4-1-2-5-19(18)22(27)31/h1-2,4-5,7-10,17H,3,6,11-14H2 |
| InChIKey | XRXPAQRNDFBAEU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|