C24H23F3N2O3 — CID 139919168
2-[3-[1-[4-(trifluoromethyl)benzoyl]piperidin-4-yl]propyl]isoindole-1,3-dione (PubChem CID 139919168) has the molecular formula C24H23F3N2O3 and a molecular weight of 444.45 g/mol. Its IUPAC name is 2-[3-[1-[4-(trifluoromethyl)benzoyl]piperidin-4-yl]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[1-[4-(trifluoromethyl)benzoyl]piperidin-4-yl]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 139919168 |
| Molecular Formula | C24H23F3N2O3 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 2-[3-[1-[4-(trifluoromethyl)benzoyl]piperidin-4-yl]propyl]isoindole-1,3-dione |
| SMILES | O=C(c1ccc(C(F)(F)F)cc1)N1CCC(CCCN2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C24H23F3N2O3/c25-24(26,27)18-9-7-17(8-10-18)21(30)28-14-11-16(12-15-28)4-3-13-29-22(31)19-5-1-2-6-20(19)23(29)32/h1-2,5-10,16H,3-4,11-15H2 |
| InChIKey | DMEGMFLGIIFRGK-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|