C34H33F3N4O4 — CID 68516902
2-[4-(1,3-dioxoisoindol-2-yl)piperidin-1-yl]-N-phenyl-N-[1-[4-(trifluoromethyl)benzoyl]piperidin-4-yl]acetamide (PubChem CID 68516902) has the molecular formula C34H33F3N4O4 and a molecular weight of 618.66 g/mol. Its IUPAC name is 2-[4-(1,3-dioxoisoindol-2-yl)piperidin-1-yl]-N-phenyl-N-[1-[4-(trifluoromethyl)benzoyl]piperidin-4-yl]acetamide.
| Compound Name | 2-[4-(1,3-dioxoisoindol-2-yl)piperidin-1-yl]-N-phenyl-N-[1-[4-(trifluoromethyl)benzoyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 68516902 |
| Molecular Formula | C34H33F3N4O4 |
| Molecular Weight | 618.66 g/mol |
| Exact Mass | 618.25 |
| IUPAC Name | 2-[4-(1,3-dioxoisoindol-2-yl)piperidin-1-yl]-N-phenyl-N-[1-[4-(trifluoromethyl)benzoyl]piperidin-4-yl]acetamide |
| SMILES | O=C(c1ccc(C(F)(F)F)cc1)N1CCC(N(C(=O)CN2CCC(N3C(=O)c4ccccc4C3=O)CC2)c2ccccc2)CC1 |
| InChI | InChI=1S/C34H33F3N4O4/c35-34(36,37)24-12-10-23(11-13-24)31(43)39-20-16-26(17-21-39)40(25-6-2-1-3-7-25)30(42)22-38-18-14-27(15-19-38)41-32(44)28-8-4-5-9-29(28)33(41)45/h1-13,26-27H,14-22H2 |
| InChIKey | XGBVWVHJXYBPRH-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.66 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|