C25H25F3N4O2 — CID 139919009
5-methyl-2-[3-[1-[4-(trifluoromethyl)benzoyl]piperidin-4-yl]propyl]-2,6,11-triazatricyclo[5.3.1.04,11]undeca-1(10),4,6,8-tetraen-3-one (PubChem CID 139919009) has the molecular formula C25H25F3N4O2 and a molecular weight of 470.50 g/mol. Its IUPAC name is 5-methyl-2-[3-[1-[4-(trifluoromethyl)benzoyl]piperidin-4-yl]propyl]-2,6,11-triazatricyclo[5.3.1.04,11]undeca-1(10),4,6,8-tetraen-3-one.
| Compound Name | 5-methyl-2-[3-[1-[4-(trifluoromethyl)benzoyl]piperidin-4-yl]propyl]-2,6,11-triazatricyclo[5.3.1.04,11]undeca-1(10),4,6,8-tetraen-3-one |
|---|---|
| PubChem CID | 139919009 |
| Molecular Formula | C25H25F3N4O2 |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 5-methyl-2-[3-[1-[4-(trifluoromethyl)benzoyl]piperidin-4-yl]propyl]-2,6,11-triazatricyclo[5.3.1.04,11]undeca-1(10),4,6,8-tetraen-3-one |
| SMILES | Cc1nc2cccc3n(CCCC4CCN(C(=O)c5ccc(C(F)(F)F)cc5)CC4)c(=O)c1n23 |
| InChI | InChI=1S/C25H25F3N4O2/c1-16-22-24(34)31(21-6-2-5-20(29-16)32(21)22)13-3-4-17-11-14-30(15-12-17)23(33)18-7-9-19(10-8-18)25(26,27)28/h2,5-10,17H,3-4,11-15H2,1H3 |
| InChIKey | JQCPEIZMQMYSDC-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 59.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |