C19H24N2O3 — CID 86868528
N-(cyclopentylmethyl)-4-(1,3-dioxoisoindol-2-yl)-N-methylbutanamide (PubChem CID 86868528) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is N-(cyclopentylmethyl)-4-(1,3-dioxoisoindol-2-yl)-N-methylbutanamide.
| Compound Name | N-(cyclopentylmethyl)-4-(1,3-dioxoisoindol-2-yl)-N-methylbutanamide |
|---|---|
| PubChem CID | 86868528 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | N-(cyclopentylmethyl)-4-(1,3-dioxoisoindol-2-yl)-N-methylbutanamide |
| SMILES | CN(CC1CCCC1)C(=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H24N2O3/c1-20(13-14-7-2-3-8-14)17(22)11-6-12-21-18(23)15-9-4-5-10-16(15)19(21)24/h4-5,9-10,14H,2-3,6-8,11-13H2,1H3 |
| InChIKey | PJHGCKRMWWCKIC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|