C19H25N3O4 — CID 18118114
N-[2-(tert-butylamino)-2-oxoethyl]-4-(1,3-dioxoisoindol-2-yl)-N-methylbutanamide (PubChem CID 18118114) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is N-[2-(tert-butylamino)-2-oxoethyl]-4-(1,3-dioxoisoindol-2-yl)-N-methylbutanamide.
| Compound Name | N-[2-(tert-butylamino)-2-oxoethyl]-4-(1,3-dioxoisoindol-2-yl)-N-methylbutanamide |
|---|---|
| PubChem CID | 18118114 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | N-[2-(tert-butylamino)-2-oxoethyl]-4-(1,3-dioxoisoindol-2-yl)-N-methylbutanamide |
| SMILES | CN(CC(=O)NC(C)(C)C)C(=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H25N3O4/c1-19(2,3)20-15(23)12-21(4)16(24)10-7-11-22-17(25)13-8-5-6-9-14(13)18(22)26/h5-6,8-9H,7,10-12H2,1-4H3,(H,20,23) |
| InChIKey | DWDRGTOHQOPTHH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|