C20H18BrFN2O3 — CID 55580584
N-[(5-bromo-2-fluorophenyl)methyl]-4-(1,3-dioxoisoindol-2-yl)-N-methylbutanamide (PubChem CID 55580584) has the molecular formula C20H18BrFN2O3 and a molecular weight of 433.28 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-4-(1,3-dioxoisoindol-2-yl)-N-methylbutanamide.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-4-(1,3-dioxoisoindol-2-yl)-N-methylbutanamide |
|---|---|
| PubChem CID | 55580584 |
| Molecular Formula | C20H18BrFN2O3 |
| Molecular Weight | 433.28 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-4-(1,3-dioxoisoindol-2-yl)-N-methylbutanamide |
| SMILES | CN(Cc1cc(Br)ccc1F)C(=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H18BrFN2O3/c1-23(12-13-11-14(21)8-9-17(13)22)18(25)7-4-10-24-19(26)15-5-2-3-6-16(15)20(24)27/h2-3,5-6,8-9,11H,4,7,10,12H2,1H3 |
| InChIKey | RDTBFVXUBBOMIN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.28 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|