C22H23BrN2O3 — CID 46539413
4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(4-ethylphenyl)methyl]-N-methylbutanamide (PubChem CID 46539413) has the molecular formula C22H23BrN2O3 and a molecular weight of 443.34 g/mol. Its IUPAC name is 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(4-ethylphenyl)methyl]-N-methylbutanamide.
| Compound Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(4-ethylphenyl)methyl]-N-methylbutanamide |
|---|---|
| PubChem CID | 46539413 |
| Molecular Formula | C22H23BrN2O3 |
| Molecular Weight | 443.34 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(4-ethylphenyl)methyl]-N-methylbutanamide |
| SMILES | CCc1ccc(CN(C)C(=O)CCCN2C(=O)c3ccc(Br)cc3C2=O)cc1 |
| InChI | InChI=1S/C22H23BrN2O3/c1-3-15-6-8-16(9-7-15)14-24(2)20(26)5-4-12-25-21(27)18-11-10-17(23)13-19(18)22(25)28/h6-11,13H,3-5,12,14H2,1-2H3 |
| InChIKey | CJGPEPNUYRBUFE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.34 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|