C12H11BrN2O2S — CID 62667369
4-(5-bromo-1,3-dioxoisoindol-2-yl)butanethioamide (PubChem CID 62667369) has the molecular formula C12H11BrN2O2S and a molecular weight of 327.20 g/mol. Its IUPAC name is 4-(5-bromo-1,3-dioxoisoindol-2-yl)butanethioamide.
| Compound Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)butanethioamide |
|---|---|
| PubChem CID | 62667369 |
| Molecular Formula | C12H11BrN2O2S |
| Molecular Weight | 327.20 g/mol |
| Exact Mass | 325.97 |
| IUPAC Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)butanethioamide |
| SMILES | NC(=S)CCCN1C(=O)c2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C12H11BrN2O2S/c13-7-3-4-8-9(6-7)12(17)15(11(8)16)5-1-2-10(14)18/h3-4,6H,1-2,5H2,(H2,14,18) |
| InChIKey | NFXKQCMVKNCXSM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.20 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|