C13H18BrFN2O — CID 115155762
N-[(5-bromo-2-fluorophenyl)methyl]-N-methyl-4-(methylamino)butanamide (PubChem CID 115155762) has the molecular formula C13H18BrFN2O and a molecular weight of 317.20 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-N-methyl-4-(methylamino)butanamide.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-N-methyl-4-(methylamino)butanamide |
|---|---|
| PubChem CID | 115155762 |
| Molecular Formula | C13H18BrFN2O |
| Molecular Weight | 317.20 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-N-methyl-4-(methylamino)butanamide |
| SMILES | CNCCCC(=O)N(C)Cc1cc(Br)ccc1F |
| InChI | InChI=1S/C13H18BrFN2O/c1-16-7-3-4-13(18)17(2)9-10-8-11(14)5-6-12(10)15/h5-6,8,16H,3-4,7,9H2,1-2H3 |
| InChIKey | XYGNQVKRCFSNNH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.20 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|