C14H16F3NOS — CID 134004426
N-cyclopropyl-2-methylsulfanyl-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide (PubChem CID 134004426) has the molecular formula C14H16F3NOS and a molecular weight of 303.35 g/mol. Its IUPAC name is N-cyclopropyl-2-methylsulfanyl-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide.
| Compound Name | N-cyclopropyl-2-methylsulfanyl-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 134004426 |
| Molecular Formula | C14H16F3NOS |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | N-cyclopropyl-2-methylsulfanyl-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide |
| SMILES | CSCC(=O)N(Cc1ccc(C(F)(F)F)cc1)C1CC1 |
| InChI | InChI=1S/C14H16F3NOS/c1-20-9-13(19)18(12-6-7-12)8-10-2-4-11(5-3-10)14(15,16)17/h2-5,12H,6-9H2,1H3 |
| InChIKey | VFWJPLYICBVOIL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |