C18H17F3N2O2 — CID 71909108
N-cyclopropyl-1-methyl-6-oxo-N-[[4-(trifluoromethyl)phenyl]methyl]pyridine-2-carboxamide (PubChem CID 71909108) has the molecular formula C18H17F3N2O2 and a molecular weight of 350.34 g/mol. Its IUPAC name is N-cyclopropyl-1-methyl-6-oxo-N-[[4-(trifluoromethyl)phenyl]methyl]pyridine-2-carboxamide.
| Compound Name | N-cyclopropyl-1-methyl-6-oxo-N-[[4-(trifluoromethyl)phenyl]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 71909108 |
| Molecular Formula | C18H17F3N2O2 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | N-cyclopropyl-1-methyl-6-oxo-N-[[4-(trifluoromethyl)phenyl]methyl]pyridine-2-carboxamide |
| SMILES | Cn1c(C(=O)N(Cc2ccc(C(F)(F)F)cc2)C2CC2)cccc1=O |
| InChI | InChI=1S/C18H17F3N2O2/c1-22-15(3-2-4-16(22)24)17(25)23(14-9-10-14)11-12-5-7-13(8-6-12)18(19,20)21/h2-8,14H,9-11H2,1H3 |
| InChIKey | BDMUFJYTPXHVHU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |