C17H15F3N2O2 — CID 25352952
N-cyclopropyl-2-oxo-N-[[4-(trifluoromethyl)phenyl]methyl]-1H-pyridine-3-carboxamide (PubChem CID 25352952) has the molecular formula C17H15F3N2O2 and a molecular weight of 336.31 g/mol. Its IUPAC name is N-cyclopropyl-2-oxo-N-[[4-(trifluoromethyl)phenyl]methyl]-1H-pyridine-3-carboxamide.
| Compound Name | N-cyclopropyl-2-oxo-N-[[4-(trifluoromethyl)phenyl]methyl]-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 25352952 |
| Molecular Formula | C17H15F3N2O2 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-cyclopropyl-2-oxo-N-[[4-(trifluoromethyl)phenyl]methyl]-1H-pyridine-3-carboxamide |
| SMILES | O=C(c1ccc[nH]c1=O)N(Cc1ccc(C(F)(F)F)cc1)C1CC1 |
| InChI | InChI=1S/C17H15F3N2O2/c18-17(19,20)12-5-3-11(4-6-12)10-22(13-7-8-13)16(24)14-2-1-9-21-15(14)23/h1-6,9,13H,7-8,10H2,(H,21,23) |
| InChIKey | YCAQVYJSKOHONG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |