C25H33NO — CID 42702953
N-[(4-tert-butylphenyl)methyl]-N-cyclohexyl-2-methylbenzamide (PubChem CID 42702953) has the molecular formula C25H33NO and a molecular weight of 363.55 g/mol. Its IUPAC name is N-[(4-tert-butylphenyl)methyl]-N-cyclohexyl-2-methylbenzamide.
| Compound Name | N-[(4-tert-butylphenyl)methyl]-N-cyclohexyl-2-methylbenzamide |
|---|---|
| PubChem CID | 42702953 |
| Molecular Formula | C25H33NO |
| Molecular Weight | 363.55 g/mol |
| Exact Mass | 363.26 |
| IUPAC Name | N-[(4-tert-butylphenyl)methyl]-N-cyclohexyl-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)N(Cc1ccc(C(C)(C)C)cc1)C1CCCCC1 |
| InChI | InChI=1S/C25H33NO/c1-19-10-8-9-13-23(19)24(27)26(22-11-6-5-7-12-22)18-20-14-16-21(17-15-20)25(2,3)4/h8-10,13-17,22H,5-7,11-12,18H2,1-4H3 |
| InChIKey | DKFLIUNLAGDORR-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.55 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |