C16H16N2O4 — CID 156849952
methyl 2-cyano-6-(1,3-dioxoisoindol-2-yl)hexanoate (PubChem CID 156849952) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is methyl 2-cyano-6-(1,3-dioxoisoindol-2-yl)hexanoate.
| Compound Name | methyl 2-cyano-6-(1,3-dioxoisoindol-2-yl)hexanoate |
|---|---|
| PubChem CID | 156849952 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | methyl 2-cyano-6-(1,3-dioxoisoindol-2-yl)hexanoate |
| SMILES | COC(=O)C(C#N)CCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H16N2O4/c1-22-16(21)11(10-17)6-4-5-9-18-14(19)12-7-2-3-8-13(12)15(18)20/h2-3,7-8,11H,4-6,9H2,1H3 |
| InChIKey | WOKLTEGTJLAHSE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|