C18H18N2O4 — CID 10639819
methyl (2S)-2-amino-5-(1,3-dioxobenzo[de]isoquinolin-2-yl)pentanoate (PubChem CID 10639819) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is methyl (2S)-2-amino-5-(1,3-dioxobenzo[de]isoquinolin-2-yl)pentanoate.
| Compound Name | methyl (2S)-2-amino-5-(1,3-dioxobenzo[de]isoquinolin-2-yl)pentanoate |
|---|---|
| PubChem CID | 10639819 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | methyl (2S)-2-amino-5-(1,3-dioxobenzo[de]isoquinolin-2-yl)pentanoate |
| SMILES | COC(=O)[C@@H](N)CCCN1C(=O)c2cccc3cccc(c23)C1=O |
| InChI | InChI=1S/C18H18N2O4/c1-24-18(23)14(19)9-4-10-20-16(21)12-7-2-5-11-6-3-8-13(15(11)12)17(20)22/h2-3,5-8,14H,4,9-10,19H2,1H3/t14-/m0/s1 |
| InChIKey | QOTDJRBERPDFMH-AWEZNQCLSA-N |
| XLogP | 1.72 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|