C34H33N5O5 — CID 177427945
2,6-diamino-N,N-bis[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]hexanamide (PubChem CID 177427945) has the molecular formula C34H33N5O5 and a molecular weight of 591.67 g/mol. Its IUPAC name is 2,6-diamino-N,N-bis[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]hexanamide.
| Compound Name | 2,6-diamino-N,N-bis[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]hexanamide |
|---|---|
| PubChem CID | 177427945 |
| Molecular Formula | C34H33N5O5 |
| Molecular Weight | 591.67 g/mol |
| Exact Mass | 591.25 |
| IUPAC Name | 2,6-diamino-N,N-bis[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]hexanamide |
| SMILES | NCCCCC(N)C(=O)N(CCN1C(=O)c2cccc3cccc(c23)C1=O)CCN1C(=O)c2cccc3cccc(c23)C1=O |
| InChI | InChI=1S/C34H33N5O5/c35-16-2-1-15-27(36)34(44)37(17-19-38-30(40)23-11-3-7-21-8-4-12-24(28(21)23)31(38)41)18-20-39-32(42)25-13-5-9-22-10-6-14-26(29(22)25)33(39)43/h3-14,27H,1-2,15-20,35-36H2 |
| InChIKey | OLRXPILJDJRMHL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 147.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.67 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|