C30H47N7O3 — CID 171347578
2-[4-[4-(4-aminobutylamino)butylamino]butylamino]-N-[2-[2-(dimethylamino)ethyl]-1,3-dioxobenzo[de]isoquinolin-5-yl]acetamide (PubChem CID 171347578) has the molecular formula C30H47N7O3 and a molecular weight of 553.75 g/mol. Its IUPAC name is 2-[4-[4-(4-aminobutylamino)butylamino]butylamino]-N-[2-[2-(dimethylamino)ethyl]-1,3-dioxobenzo[de]isoquinolin-5-yl]acetamide.
| Compound Name | 2-[4-[4-(4-aminobutylamino)butylamino]butylamino]-N-[2-[2-(dimethylamino)ethyl]-1,3-dioxobenzo[de]isoquinolin-5-yl]acetamide |
|---|---|
| PubChem CID | 171347578 |
| Molecular Formula | C30H47N7O3 |
| Molecular Weight | 553.75 g/mol |
| Exact Mass | 553.37 |
| IUPAC Name | 2-[4-[4-(4-aminobutylamino)butylamino]butylamino]-N-[2-[2-(dimethylamino)ethyl]-1,3-dioxobenzo[de]isoquinolin-5-yl]acetamide |
| SMILES | CN(C)CCN1C(=O)c2cccc3cc(NC(=O)CNCCCCNCCCCNCCCCN)cc(c23)C1=O |
| InChI | InChI=1S/C30H47N7O3/c1-36(2)18-19-37-29(39)25-11-9-10-23-20-24(21-26(28(23)25)30(37)40)35-27(38)22-34-17-8-7-16-33-15-6-5-14-32-13-4-3-12-31/h9-11,20-21,32-34H,3-8,12-19,22,31H2,1-2H3,(H,35,38) |
| InChIKey | KOEZMFRLRSGMDL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.75 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|