C22H24Cl2N4O4 — CID 171356300
4-[(2,2-dichloroacetyl)amino]-N-[2-[2-(dimethylamino)ethyl]-1,3-dioxobenzo[de]isoquinolin-5-yl]butanamide (PubChem CID 171356300) has the molecular formula C22H24Cl2N4O4 and a molecular weight of 479.36 g/mol. Its IUPAC name is 4-[(2,2-dichloroacetyl)amino]-N-[2-[2-(dimethylamino)ethyl]-1,3-dioxobenzo[de]isoquinolin-5-yl]butanamide.
| Compound Name | 4-[(2,2-dichloroacetyl)amino]-N-[2-[2-(dimethylamino)ethyl]-1,3-dioxobenzo[de]isoquinolin-5-yl]butanamide |
|---|---|
| PubChem CID | 171356300 |
| Molecular Formula | C22H24Cl2N4O4 |
| Molecular Weight | 479.36 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 4-[(2,2-dichloroacetyl)amino]-N-[2-[2-(dimethylamino)ethyl]-1,3-dioxobenzo[de]isoquinolin-5-yl]butanamide |
| SMILES | CN(C)CCN1C(=O)c2cccc3cc(NC(=O)CCCNC(=O)C(Cl)Cl)cc(c23)C1=O |
| InChI | InChI=1S/C22H24Cl2N4O4/c1-27(2)9-10-28-21(31)15-6-3-5-13-11-14(12-16(18(13)15)22(28)32)26-17(29)7-4-8-25-20(30)19(23)24/h3,5-6,11-12,19H,4,7-10H2,1-2H3,(H,25,30)(H,26,29) |
| InChIKey | KSOKZDWTKSFTAG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|