C23H31N5O3 — CID 164617091
2-amino-N-[1,3-dioxo-2-[3-[3-(propylamino)propylamino]propyl]benzo[de]isoquinolin-5-yl]acetamide (PubChem CID 164617091) has the molecular formula C23H31N5O3 and a molecular weight of 425.53 g/mol. Its IUPAC name is 2-amino-N-[1,3-dioxo-2-[3-[3-(propylamino)propylamino]propyl]benzo[de]isoquinolin-5-yl]acetamide.
| Compound Name | 2-amino-N-[1,3-dioxo-2-[3-[3-(propylamino)propylamino]propyl]benzo[de]isoquinolin-5-yl]acetamide |
|---|---|
| PubChem CID | 164617091 |
| Molecular Formula | C23H31N5O3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | 2-amino-N-[1,3-dioxo-2-[3-[3-(propylamino)propylamino]propyl]benzo[de]isoquinolin-5-yl]acetamide |
| SMILES | CCCNCCCNCCCN1C(=O)c2cccc3cc(NC(=O)CN)cc(c23)C1=O |
| InChI | InChI=1S/C23H31N5O3/c1-2-8-25-9-4-10-26-11-5-12-28-22(30)18-7-3-6-16-13-17(27-20(29)15-24)14-19(21(16)18)23(28)31/h3,6-7,13-14,25-26H,2,4-5,8-12,15,24H2,1H3,(H,27,29) |
| InChIKey | NYPVCVSFRHKGQN-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|