C32H26N4O4 — CID 67770205
6-[3-[3-(5-amino-1,3-dioxobenzo[de]isoquinolin-2-yl)propylamino]propyl]-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10,12-hexaene-5,7-dione (PubChem CID 67770205) has the molecular formula C32H26N4O4 and a molecular weight of 530.58 g/mol. Its IUPAC name is 6-[3-[3-(5-amino-1,3-dioxobenzo[de]isoquinolin-2-yl)propylamino]propyl]-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10,12-hexaene-5,7-dione.
| Compound Name | 6-[3-[3-(5-amino-1,3-dioxobenzo[de]isoquinolin-2-yl)propylamino]propyl]-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10,12-hexaene-5,7-dione |
|---|---|
| PubChem CID | 67770205 |
| Molecular Formula | C32H26N4O4 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | 6-[3-[3-(5-amino-1,3-dioxobenzo[de]isoquinolin-2-yl)propylamino]propyl]-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10,12-hexaene-5,7-dione |
| SMILES | Nc1cc2c3c(cccc3c1)C(=O)N(CCCNCCCN1C(=O)c3ccc4c5c(ccc(c35)C1=O)C=C4)C2=O |
| InChI | InChI=1S/C32H26N4O4/c33-21-16-20-4-1-5-22-27(20)25(17-21)32(40)36(29(22)37)15-3-13-34-12-2-14-35-30(38)23-10-8-18-6-7-19-9-11-24(31(35)39)28(23)26(18)19/h1,4-11,16-17,34H,2-3,12-15,33H2 |
| InChIKey | VCZDFHPDMCMYTQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|