C24H28Cl2N4O4 — CID 171351791
6-[(2,2-dichloroacetyl)amino]-N-[2-[2-(dimethylamino)ethyl]-1,3-dioxobenzo[de]isoquinolin-5-yl]hexanamide (PubChem CID 171351791) has the molecular formula C24H28Cl2N4O4 and a molecular weight of 507.42 g/mol. Its IUPAC name is 6-[(2,2-dichloroacetyl)amino]-N-[2-[2-(dimethylamino)ethyl]-1,3-dioxobenzo[de]isoquinolin-5-yl]hexanamide.
| Compound Name | 6-[(2,2-dichloroacetyl)amino]-N-[2-[2-(dimethylamino)ethyl]-1,3-dioxobenzo[de]isoquinolin-5-yl]hexanamide |
|---|---|
| PubChem CID | 171351791 |
| Molecular Formula | C24H28Cl2N4O4 |
| Molecular Weight | 507.42 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | 6-[(2,2-dichloroacetyl)amino]-N-[2-[2-(dimethylamino)ethyl]-1,3-dioxobenzo[de]isoquinolin-5-yl]hexanamide |
| SMILES | CN(C)CCN1C(=O)c2cccc3cc(NC(=O)CCCCCNC(=O)C(Cl)Cl)cc(c23)C1=O |
| InChI | InChI=1S/C24H28Cl2N4O4/c1-29(2)11-12-30-23(33)17-8-6-7-15-13-16(14-18(20(15)17)24(30)34)28-19(31)9-4-3-5-10-27-22(32)21(25)26/h6-8,13-14,21H,3-5,9-12H2,1-2H3,(H,27,32)(H,28,31) |
| InChIKey | CXECXAYMBHBPNT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|