C31H26N4O4S — CID 132541612
1,1-bis[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]-3-ethylthiourea (PubChem CID 132541612) has the molecular formula C31H26N4O4S and a molecular weight of 550.64 g/mol. Its IUPAC name is 1,1-bis[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]-3-ethylthiourea.
| Compound Name | 1,1-bis[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]-3-ethylthiourea |
|---|---|
| PubChem CID | 132541612 |
| Molecular Formula | C31H26N4O4S |
| Molecular Weight | 550.64 g/mol |
| Exact Mass | 550.17 |
| IUPAC Name | 1,1-bis[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]-3-ethylthiourea |
| SMILES | CCNC(=S)N(CCN1C(=O)c2cccc3cccc(c23)C1=O)CCN1C(=O)c2cccc3cccc(c23)C1=O |
| InChI | InChI=1S/C31H26N4O4S/c1-2-32-31(40)33(15-17-34-27(36)21-11-3-7-19-8-4-12-22(25(19)21)28(34)37)16-18-35-29(38)23-13-5-9-20-10-6-14-24(26(20)23)30(35)39/h3-14H,2,15-18H2,1H3,(H,32,40) |
| InChIKey | HAJBQKWWPRBNGK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.64 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|